C13H15ClN2O3 — CID 1220180
(5-chloro-2-nitrophenyl)-[(3R)-3-methylpiperidin-1-yl]methanone (PubChem CID 1220180) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is (5-chloro-2-nitrophenyl)-[(3R)-3-methylpiperidin-1-yl]methanone.
| Compound Name | (5-chloro-2-nitrophenyl)-[(3R)-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 1220180 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (5-chloro-2-nitrophenyl)-[(3R)-3-methylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCCN(C(=O)c2cc(Cl)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H15ClN2O3/c1-9-3-2-6-15(8-9)13(17)11-7-10(14)4-5-12(11)16(18)19/h4-5,7,9H,2-3,6,8H2,1H3/t9-/m1/s1 |
| InChIKey | YRCYPHKIAUZZNY-SECBINFHSA-N |
| XLogP | 3.12 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|