About 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid
3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid (PubChem CID 122018001) has the molecular formula C14H17BrN2O3
and a molecular weight of 341.21 g/mol. Its IUPAC name is 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid |
| PubChem CID | 122018001 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid |
| SMILES | CC1c2cccc(Br)c2CCN1C(=O)NCCC(=O)O |
| InChI | InChI=1S/C14H17BrN2O3/c1-9-10-3-2-4-12(15)11(10)6-8-17(9)14(20)16-7-5-13(18)19/h2-4,9H,5-8H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | PMIIOBMORVWFAV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid (CID 122018001) is 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid is CC1c2cccc(Br)c2CCN1C(=O)NCCC(=O)O.
What is the InChIKey of 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid?
The InChIKey is PMIIOBMORVWFAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O3/c1-9-10-3-2-4-12(15)11(10)6-8-17(9)14(20)16-7-5-13(18)19/h2-4,9H,5-8H2,1H3,(H,16,20)(H,18,19).
What are the key properties of 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid?
3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid has a molecular weight of 341.21 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]propanoic acid is sourced from PubChem (CID 122018001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).