C16H19ClN4O3 — CID 122018265
3-[[(4-chlorophenyl)methyl-[(1-methylpyrazol-4-yl)methyl]carbamoyl]amino]propanoic acid (PubChem CID 122018265) has the molecular formula C16H19ClN4O3 and a molecular weight of 350.81 g/mol. Its IUPAC name is 3-[[(4-chlorophenyl)methyl-[(1-methylpyrazol-4-yl)methyl]carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[(4-chlorophenyl)methyl-[(1-methylpyrazol-4-yl)methyl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122018265 |
| Molecular Formula | C16H19ClN4O3 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 3-[[(4-chlorophenyl)methyl-[(1-methylpyrazol-4-yl)methyl]carbamoyl]amino]propanoic acid |
| SMILES | Cn1cc(CN(Cc2ccc(Cl)cc2)C(=O)NCCC(=O)O)cn1 |
| InChI | InChI=1S/C16H19ClN4O3/c1-20-9-13(8-19-20)11-21(16(24)18-7-6-15(22)23)10-12-2-4-14(17)5-3-12/h2-5,8-9H,6-7,10-11H2,1H3,(H,18,24)(H,22,23) |
| InChIKey | DMTJYPWWDZKQIP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |