C16H21BrN2O3 — CID 122018494
3-[[(2-bromophenyl)methyl-cyclopentylcarbamoyl]amino]propanoic acid (PubChem CID 122018494) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is 3-[[(2-bromophenyl)methyl-cyclopentylcarbamoyl]amino]propanoic acid.
| Compound Name | 3-[[(2-bromophenyl)methyl-cyclopentylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122018494 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-[[(2-bromophenyl)methyl-cyclopentylcarbamoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N(Cc1ccccc1Br)C1CCCC1 |
| InChI | InChI=1S/C16H21BrN2O3/c17-14-8-4-1-5-12(14)11-19(13-6-2-3-7-13)16(22)18-10-9-15(20)21/h1,4-5,8,13H,2-3,6-7,9-11H2,(H,18,22)(H,20,21) |
| InChIKey | ZLDKFOJIHLXHIP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |