C21H24N2O3 — CID 122019905
4-[[[methyl-(2-phenylcyclopentyl)carbamoyl]amino]methyl]benzoic acid (PubChem CID 122019905) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[[[methyl-(2-phenylcyclopentyl)carbamoyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[methyl-(2-phenylcyclopentyl)carbamoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122019905 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-[[[methyl-(2-phenylcyclopentyl)carbamoyl]amino]methyl]benzoic acid |
| SMILES | CN(C(=O)NCc1ccc(C(=O)O)cc1)C1CCCC1c1ccccc1 |
| InChI | InChI=1S/C21H24N2O3/c1-23(19-9-5-8-18(19)16-6-3-2-4-7-16)21(26)22-14-15-10-12-17(13-11-15)20(24)25/h2-4,6-7,10-13,18-19H,5,8-9,14H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | ZITUKXCBRMVXRA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |