C22H25N3O4 — CID 122020331
4-[[[3-(benzamidomethyl)piperidine-1-carbonyl]amino]methyl]benzoic acid (PubChem CID 122020331) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[[[3-(benzamidomethyl)piperidine-1-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[3-(benzamidomethyl)piperidine-1-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020331 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 4-[[[3-(benzamidomethyl)piperidine-1-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)N2CCCC(CNC(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H25N3O4/c26-20(18-6-2-1-3-7-18)23-14-17-5-4-12-25(15-17)22(29)24-13-16-8-10-19(11-9-16)21(27)28/h1-3,6-11,17H,4-5,12-15H2,(H,23,26)(H,24,29)(H,27,28) |
| InChIKey | WUBSEPYGJGWFLS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |