C12H20N2O5 — CID 122022100
4-[[2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carbonyl]amino]butanoic acid (PubChem CID 122022100) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-[[2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022100 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-[[2-(2-methoxy-2-oxoethyl)pyrrolidine-1-carbonyl]amino]butanoic acid |
| SMILES | COC(=O)CC1CCCN1C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C12H20N2O5/c1-19-11(17)8-9-4-3-7-14(9)12(18)13-6-2-5-10(15)16/h9H,2-8H2,1H3,(H,13,18)(H,15,16) |
| InChIKey | TVAPLYLXGIIMRF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|