C17H26N2O4 — CID 122022375
4-[[[(2S)-1-hydroxypropan-2-yl]-(2-phenylpropyl)carbamoyl]amino]butanoic acid (PubChem CID 122022375) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[[[(2S)-1-hydroxypropan-2-yl]-(2-phenylpropyl)carbamoyl]amino]butanoic acid.
| Compound Name | 4-[[[(2S)-1-hydroxypropan-2-yl]-(2-phenylpropyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022375 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-[[[(2S)-1-hydroxypropan-2-yl]-(2-phenylpropyl)carbamoyl]amino]butanoic acid |
| SMILES | CC(CN(C(=O)NCCCC(=O)O)[C@@H](C)CO)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O4/c1-13(15-7-4-3-5-8-15)11-19(14(2)12-20)17(23)18-10-6-9-16(21)22/h3-5,7-8,13-14,20H,6,9-12H2,1-2H3,(H,18,23)(H,21,22)/t13?,14-/m0/s1 |
| InChIKey | DOGUHJDMXHSEGY-KZUDCZAMSA-N |
| XLogP | 2.05 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|