C20H25N3O4 — CID 122022550
4-[[(4-methoxyphenyl)methyl-(2-pyridin-2-ylethyl)carbamoyl]amino]butanoic acid (PubChem CID 122022550) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-[[(4-methoxyphenyl)methyl-(2-pyridin-2-ylethyl)carbamoyl]amino]butanoic acid.
| Compound Name | 4-[[(4-methoxyphenyl)methyl-(2-pyridin-2-ylethyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022550 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-[[(4-methoxyphenyl)methyl-(2-pyridin-2-ylethyl)carbamoyl]amino]butanoic acid |
| SMILES | COc1ccc(CN(CCc2ccccn2)C(=O)NCCCC(=O)O)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-27-18-9-7-16(8-10-18)15-23(14-11-17-5-2-3-12-21-17)20(26)22-13-4-6-19(24)25/h2-3,5,7-10,12H,4,6,11,13-15H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | PNHXESRBCXKWDG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|