C13H20N2O5 — CID 122022555
4-[[2-hydroxyethyl-[(5-methylfuran-2-yl)methyl]carbamoyl]amino]butanoic acid (PubChem CID 122022555) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-[[2-hydroxyethyl-[(5-methylfuran-2-yl)methyl]carbamoyl]amino]butanoic acid.
| Compound Name | 4-[[2-hydroxyethyl-[(5-methylfuran-2-yl)methyl]carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022555 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-[[2-hydroxyethyl-[(5-methylfuran-2-yl)methyl]carbamoyl]amino]butanoic acid |
| SMILES | Cc1ccc(CN(CCO)C(=O)NCCCC(=O)O)o1 |
| InChI | InChI=1S/C13H20N2O5/c1-10-4-5-11(20-10)9-15(7-8-16)13(19)14-6-2-3-12(17)18/h4-5,16H,2-3,6-9H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | BEEISBAMWPINQI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|