C16H22BrN3O3 — CID 122022578
4-[[3-(3-bromoanilino)piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 122022578) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is 4-[[3-(3-bromoanilino)piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[3-(3-bromoanilino)piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022578 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-[[3-(3-bromoanilino)piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCCC(Nc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H22BrN3O3/c17-12-4-1-5-13(10-12)19-14-6-3-9-20(11-14)16(23)18-8-2-7-15(21)22/h1,4-5,10,14,19H,2-3,6-9,11H2,(H,18,23)(H,21,22) |
| InChIKey | MKDRIAAWNNJDBB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|