C14H19F3N4O3 — CID 122022915
4-[[4-[3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 122022915) has the molecular formula C14H19F3N4O3 and a molecular weight of 348.33 g/mol. Its IUPAC name is 4-[[4-[3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-[3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022915 |
| Molecular Formula | C14H19F3N4O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-[[4-[3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCC(n2ccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C14H19F3N4O3/c15-14(16,17)11-5-9-21(19-11)10-3-7-20(8-4-10)13(24)18-6-1-2-12(22)23/h5,9-10H,1-4,6-8H2,(H,18,24)(H,22,23) |
| InChIKey | CCRAXJRABRMWFS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|