C16H25N3O4 — CID 122023987
4-[[(4aR,7aS)-6-methyl-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122023987) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[[(4aR,7aS)-6-methyl-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(4aR,7aS)-6-methyl-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122023987 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 4-[[(4aR,7aS)-6-methyl-5-oxo-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CN1C[C@@H]2[C@@H](CCCN2C(=O)NC2CCC(C(=O)O)CC2)C1=O |
| InChI | InChI=1S/C16H25N3O4/c1-18-9-13-12(14(18)20)3-2-8-19(13)16(23)17-11-6-4-10(5-7-11)15(21)22/h10-13H,2-9H2,1H3,(H,17,23)(H,21,22)/t10?,11?,12-,13-/m1/s1 |
| InChIKey | JDPVWODALUYBRM-FIYWTHMPSA-N |
| XLogP | 0.89 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |