C20H27ClN2O3 — CID 122024099
4-[[4-(3-chlorophenyl)-4-methylpiperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122024099) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is 4-[[4-(3-chlorophenyl)-4-methylpiperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[4-(3-chlorophenyl)-4-methylpiperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122024099 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-[[4-(3-chlorophenyl)-4-methylpiperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CC1(c2cccc(Cl)c2)CCN(C(=O)NC2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C20H27ClN2O3/c1-20(15-3-2-4-16(21)13-15)9-11-23(12-10-20)19(26)22-17-7-5-14(6-8-17)18(24)25/h2-4,13-14,17H,5-12H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | ULCRGJZZHAEPCP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |