C20H29N3O3 — CID 122025212
4-[[methyl-[(2-pyrrolidin-1-ylphenyl)methyl]carbamoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122025212) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[[methyl-[(2-pyrrolidin-1-ylphenyl)methyl]carbamoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[methyl-[(2-pyrrolidin-1-ylphenyl)methyl]carbamoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122025212 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-[[methyl-[(2-pyrrolidin-1-ylphenyl)methyl]carbamoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CN(Cc1ccccc1N1CCCC1)C(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C20H29N3O3/c1-22(20(26)21-17-10-8-15(9-11-17)19(24)25)14-16-6-2-3-7-18(16)23-12-4-5-13-23/h2-3,6-7,15,17H,4-5,8-14H2,1H3,(H,21,26)(H,24,25) |
| InChIKey | FQAYSDQCCXHZDK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |