C20H24N2O4 — CID 122025242
4-[[benzyl(furan-2-ylmethyl)carbamoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122025242) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[[benzyl(furan-2-ylmethyl)carbamoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[benzyl(furan-2-ylmethyl)carbamoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122025242 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-[[benzyl(furan-2-ylmethyl)carbamoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)N(Cc2ccccc2)Cc2ccco2)CC1 |
| InChI | InChI=1S/C20H24N2O4/c23-19(24)16-8-10-17(11-9-16)21-20(25)22(14-18-7-4-12-26-18)13-15-5-2-1-3-6-15/h1-7,12,16-17H,8-11,13-14H2,(H,21,25)(H,23,24) |
| InChIKey | TVKGYBHBFHPAES-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |