C17H32N4O4 — CID 122025527
2-[[3-[[4-(2-ethoxyethyl)piperazine-1-carbonyl]amino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122025527) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[[3-[[4-(2-ethoxyethyl)piperazine-1-carbonyl]amino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[[4-(2-ethoxyethyl)piperazine-1-carbonyl]amino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122025527 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-[[3-[[4-(2-ethoxyethyl)piperazine-1-carbonyl]amino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCOCCN1CCN(C(=O)NC2CC(N(CC)CC(=O)O)C2)CC1 |
| InChI | InChI=1S/C17H32N4O4/c1-3-20(13-16(22)23)15-11-14(12-15)18-17(24)21-7-5-19(6-8-21)9-10-25-4-2/h14-15H,3-13H2,1-2H3,(H,18,24)(H,22,23) |
| InChIKey | SRUSAKRPOWPJDD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|