C17H29N3O5 — CID 122025877
2-[ethyl-[3-[[3-(oxolan-2-yl)morpholine-4-carbonyl]amino]cyclobutyl]amino]acetic acid (PubChem CID 122025877) has the molecular formula C17H29N3O5 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[ethyl-[3-[[3-(oxolan-2-yl)morpholine-4-carbonyl]amino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[[3-(oxolan-2-yl)morpholine-4-carbonyl]amino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122025877 |
| Molecular Formula | C17H29N3O5 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-[ethyl-[3-[[3-(oxolan-2-yl)morpholine-4-carbonyl]amino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)N2CCOCC2C2CCCO2)C1 |
| InChI | InChI=1S/C17H29N3O5/c1-2-19(10-16(21)22)13-8-12(9-13)18-17(23)20-5-7-24-11-14(20)15-4-3-6-25-15/h12-15H,2-11H2,1H3,(H,18,23)(H,21,22) |
| InChIKey | FMPDQKILSWUCEJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |