C18H24N4O5 — CID 122027397
4-[[4-(2-amino-2-oxoethyl)-3-oxopiperazine-1-carbonyl]amino]-5-phenylpentanoic acid (PubChem CID 122027397) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[[4-(2-amino-2-oxoethyl)-3-oxopiperazine-1-carbonyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[4-(2-amino-2-oxoethyl)-3-oxopiperazine-1-carbonyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027397 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 4-[[4-(2-amino-2-oxoethyl)-3-oxopiperazine-1-carbonyl]amino]-5-phenylpentanoic acid |
| SMILES | NC(=O)CN1CCN(C(=O)NC(CCC(=O)O)Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C18H24N4O5/c19-15(23)11-21-8-9-22(12-16(21)24)18(27)20-14(6-7-17(25)26)10-13-4-2-1-3-5-13/h1-5,14H,6-12H2,(H2,19,23)(H,20,27)(H,25,26) |
| InChIKey | KKBMWSOLTYKMBS-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |