C22H27N3O3 — CID 122028137
4-[(4-methyl-2-pyridin-3-ylpyrrolidine-1-carbonyl)amino]-5-phenylpentanoic acid (PubChem CID 122028137) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[(4-methyl-2-pyridin-3-ylpyrrolidine-1-carbonyl)amino]-5-phenylpentanoic acid.
| Compound Name | 4-[(4-methyl-2-pyridin-3-ylpyrrolidine-1-carbonyl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122028137 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[(4-methyl-2-pyridin-3-ylpyrrolidine-1-carbonyl)amino]-5-phenylpentanoic acid |
| SMILES | CC1CC(c2cccnc2)N(C(=O)NC(CCC(=O)O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-16-12-20(18-8-5-11-23-14-18)25(15-16)22(28)24-19(9-10-21(26)27)13-17-6-3-2-4-7-17/h2-8,11,14,16,19-20H,9-10,12-13,15H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | HICXTHPDOGQTID-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |