C21H26N2O5 — CID 122028366
4-[[3-(5-methylfuran-2-yl)morpholine-4-carbonyl]amino]-5-phenylpentanoic acid (PubChem CID 122028366) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[[3-(5-methylfuran-2-yl)morpholine-4-carbonyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[3-(5-methylfuran-2-yl)morpholine-4-carbonyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122028366 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-[[3-(5-methylfuran-2-yl)morpholine-4-carbonyl]amino]-5-phenylpentanoic acid |
| SMILES | Cc1ccc(C2COCCN2C(=O)NC(CCC(=O)O)Cc2ccccc2)o1 |
| InChI | InChI=1S/C21H26N2O5/c1-15-7-9-19(28-15)18-14-27-12-11-23(18)21(26)22-17(8-10-20(24)25)13-16-5-3-2-4-6-16/h2-7,9,17-18H,8,10-14H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | KJJDVKVXSJDAEM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |