C19H18Cl2N2O3 — CID 122028709
3-[[2-[(3,5-dichlorophenyl)carbamoyl]pyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 122028709) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 3-[[2-[(3,5-dichlorophenyl)carbamoyl]pyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[2-[(3,5-dichlorophenyl)carbamoyl]pyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122028709 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3-[[2-[(3,5-dichlorophenyl)carbamoyl]pyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCCC2C(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c20-14-8-15(21)10-16(9-14)22-18(24)17-5-2-6-23(17)11-12-3-1-4-13(7-12)19(25)26/h1,3-4,7-10,17H,2,5-6,11H2,(H,22,24)(H,25,26) |
| InChIKey | VKMDVPPKNIJWKZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |