C23H30N2O3 — CID 122029023
3-[[[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]methyl-methylamino]methyl]benzoic acid (PubChem CID 122029023) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3-[[[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]methyl-methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]methyl-methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122029023 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-[[[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]methyl-methylamino]methyl]benzoic acid |
| SMILES | CN(Cc1cccc(C(=O)O)c1)CC1CCN(CC(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O3/c1-24(16-19-6-5-9-21(14-19)23(27)28)15-18-10-12-25(13-11-18)17-22(26)20-7-3-2-4-8-20/h2-9,14,18,22,26H,10-13,15-17H2,1H3,(H,27,28) |
| InChIKey | GSCZBRBZGPZWJX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |