C19H21BrN2O2 — CID 122030579
3-[[[1-(4-bromophenyl)pyrrolidin-3-yl]methylamino]methyl]benzoic acid (PubChem CID 122030579) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is 3-[[[1-(4-bromophenyl)pyrrolidin-3-yl]methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[1-(4-bromophenyl)pyrrolidin-3-yl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030579 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-[[[1-(4-bromophenyl)pyrrolidin-3-yl]methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCC2CCN(c3ccc(Br)cc3)C2)c1 |
| InChI | InChI=1S/C19H21BrN2O2/c20-17-4-6-18(7-5-17)22-9-8-15(13-22)12-21-11-14-2-1-3-16(10-14)19(23)24/h1-7,10,15,21H,8-9,11-13H2,(H,23,24) |
| InChIKey | IXZCCLIVXZEYHB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |