C19H20FNO2 — CID 122033086
4-[[[1-[(3-fluorophenyl)methyl]cyclobutyl]amino]methyl]benzoic acid (PubChem CID 122033086) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is 4-[[[1-[(3-fluorophenyl)methyl]cyclobutyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1-[(3-fluorophenyl)methyl]cyclobutyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122033086 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-[[[1-[(3-fluorophenyl)methyl]cyclobutyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC2(Cc3cccc(F)c3)CCC2)cc1 |
| InChI | InChI=1S/C19H20FNO2/c20-17-4-1-3-15(11-17)12-19(9-2-10-19)21-13-14-5-7-16(8-6-14)18(22)23/h1,3-8,11,21H,2,9-10,12-13H2,(H,22,23) |
| InChIKey | ZVVOPWLEIZTHSN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |