About 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid
4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid (PubChem CID 122033630) has the molecular formula C16H21N3O3
and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid |
| PubChem CID | 122033630 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid |
| SMILES | NC(=O)N1CCc2ccc(NC3CCC(C(=O)O)CC3)cc21 |
| InChI | InChI=1S/C16H21N3O3/c17-16(22)19-8-7-10-1-6-13(9-14(10)19)18-12-4-2-11(3-5-12)15(20)21/h1,6,9,11-12,18H,2-5,7-8H2,(H2,17,22)(H,20,21) |
| InChIKey | RHCZZWZDYANNOB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid (CID 122033630) is 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid is NC(=O)N1CCc2ccc(NC3CCC(C(=O)O)CC3)cc21.
What is the InChIKey of 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid?
The InChIKey is RHCZZWZDYANNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3/c17-16(22)19-8-7-10-1-6-13(9-14(10)19)18-12-4-2-11(3-5-12)15(20)21/h1,6,9,11-12,18H,2-5,7-8H2,(H2,17,22)(H,20,21).
What are the key properties of 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid?
4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid has a molecular weight of 303.36 g/mol, XLogP of 2.18, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-carbamoyl-2,3-dihydroindol-6-yl)amino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 122033630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).