C16H20N2O4 — CID 122033997
3-[[(1-methyl-2,5-dioxopyrrolidin-3-yl)-propylamino]methyl]benzoic acid (PubChem CID 122033997) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-[[(1-methyl-2,5-dioxopyrrolidin-3-yl)-propylamino]methyl]benzoic acid.
| Compound Name | 3-[[(1-methyl-2,5-dioxopyrrolidin-3-yl)-propylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122033997 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[[(1-methyl-2,5-dioxopyrrolidin-3-yl)-propylamino]methyl]benzoic acid |
| SMILES | CCCN(Cc1cccc(C(=O)O)c1)C1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C16H20N2O4/c1-3-7-18(13-9-14(19)17(2)15(13)20)10-11-5-4-6-12(8-11)16(21)22/h4-6,8,13H,3,7,9-10H2,1-2H3,(H,21,22) |
| InChIKey | PSYBREKNIXQODJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|