C18H24FNO4 — CID 122034174
4-[4-fluoro-2-(oxan-4-yloxy)anilino]cyclohexane-1-carboxylic acid (PubChem CID 122034174) has the molecular formula C18H24FNO4 and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-[4-fluoro-2-(oxan-4-yloxy)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-fluoro-2-(oxan-4-yloxy)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122034174 |
| Molecular Formula | C18H24FNO4 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-[4-fluoro-2-(oxan-4-yloxy)anilino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2ccc(F)cc2OC2CCOCC2)CC1 |
| InChI | InChI=1S/C18H24FNO4/c19-13-3-6-16(17(11-13)24-15-7-9-23-10-8-15)20-14-4-1-12(2-5-14)18(21)22/h3,6,11-12,14-15,20H,1-2,4-5,7-10H2,(H,21,22) |
| InChIKey | VGGQKZFXAAWAGM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |