C13H13BrF3NO3 — CID 122036320
1-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxylic acid (PubChem CID 122036320) has the molecular formula C13H13BrF3NO3 and a molecular weight of 368.15 g/mol. Its IUPAC name is 1-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122036320 |
| Molecular Formula | C13H13BrF3NO3 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 1-[[3-bromo-4-(trifluoromethoxy)phenyl]methyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(Cc2ccc(OC(F)(F)F)c(Br)c2)C1 |
| InChI | InChI=1S/C13H13BrF3NO3/c14-10-5-8(1-2-11(10)21-13(15,16)17)6-18-4-3-9(7-18)12(19)20/h1-2,5,9H,3-4,6-7H2,(H,19,20) |
| InChIKey | KQNFWJLUIGEETC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |