C16H23NO3 — CID 122037040
(2S)-2-[3-(2,3-dihydro-1-benzofuran-5-yl)propylamino]-3-methylbutanoic acid (PubChem CID 122037040) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2S)-2-[3-(2,3-dihydro-1-benzofuran-5-yl)propylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[3-(2,3-dihydro-1-benzofuran-5-yl)propylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122037040 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (2S)-2-[3-(2,3-dihydro-1-benzofuran-5-yl)propylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NCCCc1ccc2c(c1)CCO2)C(=O)O |
| InChI | InChI=1S/C16H23NO3/c1-11(2)15(16(18)19)17-8-3-4-12-5-6-14-13(10-12)7-9-20-14/h5-6,10-11,15,17H,3-4,7-9H2,1-2H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | YDYJJWWGOOZLJG-HNNXBMFYSA-N |
| XLogP | 2.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|