C18H16F3NO2 — CID 122037747
(2R)-3-phenyl-2-[(5,6,7-trifluoro-2,3-dihydro-1H-inden-1-yl)amino]propanoic acid (PubChem CID 122037747) has the molecular formula C18H16F3NO2 and a molecular weight of 335.32 g/mol. Its IUPAC name is (2R)-3-phenyl-2-[(5,6,7-trifluoro-2,3-dihydro-1H-inden-1-yl)amino]propanoic acid.
| Compound Name | (2R)-3-phenyl-2-[(5,6,7-trifluoro-2,3-dihydro-1H-inden-1-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 122037747 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (2R)-3-phenyl-2-[(5,6,7-trifluoro-2,3-dihydro-1H-inden-1-yl)amino]propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)NC1CCc2cc(F)c(F)c(F)c21 |
| InChI | InChI=1S/C18H16F3NO2/c19-12-9-11-6-7-13(15(11)17(21)16(12)20)22-14(18(23)24)8-10-4-2-1-3-5-10/h1-5,9,13-14,22H,6-8H2,(H,23,24)/t13?,14-/m1/s1 |
| InChIKey | AZDURYWGJNSDFZ-ARLHGKGLSA-N |
| XLogP | 3.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|