C18H21NO3 — CID 122038070
(2R)-2-[2-(4-methoxyphenyl)propylamino]-2-phenylacetic acid (PubChem CID 122038070) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (2R)-2-[2-(4-methoxyphenyl)propylamino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[2-(4-methoxyphenyl)propylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 122038070 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2R)-2-[2-(4-methoxyphenyl)propylamino]-2-phenylacetic acid |
| SMILES | COc1ccc(C(C)CN[C@@H](C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-13(14-8-10-16(22-2)11-9-14)12-19-17(18(20)21)15-6-4-3-5-7-15/h3-11,13,17,19H,12H2,1-2H3,(H,20,21)/t13?,17-/m1/s1 |
| InChIKey | APBKGHRDINVLOF-LRHAYUFXSA-N |
| XLogP | 3.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |