C10H12ClNO2S — CID 122038756
(2S)-1-[(2-chlorothiophen-3-yl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122038756) has the molecular formula C10H12ClNO2S and a molecular weight of 245.73 g/mol. Its IUPAC name is (2S)-1-[(2-chlorothiophen-3-yl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2-chlorothiophen-3-yl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122038756 |
| Molecular Formula | C10H12ClNO2S |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | (2S)-1-[(2-chlorothiophen-3-yl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1Cc1ccsc1Cl |
| InChI | InChI=1S/C10H12ClNO2S/c11-9-7(3-5-15-9)6-12-4-1-2-8(12)10(13)14/h3,5,8H,1-2,4,6H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | LMBVOHSMYHIIFP-QMMMGPOBSA-N |
| XLogP | 2.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |