C17H17ClN2O5 — CID 122040317
1-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methyl]piperidine-2-carboxylic acid (PubChem CID 122040317) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is 1-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122040317 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1Cc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C17H17ClN2O5/c18-14-9-11(20(23)24)4-6-13(14)16-7-5-12(25-16)10-19-8-2-1-3-15(19)17(21)22/h4-7,9,15H,1-3,8,10H2,(H,21,22) |
| InChIKey | DWCLPEZORDZHIZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|