C19H25NO2 — CID 122041078
1-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 122041078) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 1-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 122041078 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-[[(1R,2R)-2-phenylcyclopropyl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1CC2CCCCC2N1C[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c21-19(22)18-11-14-8-4-5-9-17(14)20(18)12-15-10-16(15)13-6-2-1-3-7-13/h1-3,6-7,14-18H,4-5,8-12H2,(H,21,22)/t14?,15-,16-,17?,18?/m0/s1 |
| InChIKey | ILBXARWLMOXZGW-FWUSTWIJSA-N |
| XLogP | 3.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |