C14H17F3N2O2S — CID 122041116
1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 122041116) has the molecular formula C14H17F3N2O2S and a molecular weight of 334.36 g/mol. Its IUPAC name is 1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 122041116 |
| Molecular Formula | C14H17F3N2O2S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1CC2CCCCC2N1Cc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C14H17F3N2O2S/c15-14(16,17)13-18-6-9(22-13)7-19-10-4-2-1-3-8(10)5-11(19)12(20)21/h6,8,10-11H,1-5,7H2,(H,20,21) |
| InChIKey | CPAFLTNNRZMCEL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |