C20H22FNO3 — CID 122041176
1-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 122041176) has the molecular formula C20H22FNO3 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 122041176 |
| Molecular Formula | C20H22FNO3 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1CC2CCCCC2N1Cc1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H22FNO3/c21-15-7-5-13(6-8-15)19-10-9-16(25-19)12-22-17-4-2-1-3-14(17)11-18(22)20(23)24/h5-10,14,17-18H,1-4,11-12H2,(H,23,24) |
| InChIKey | KHHRUFCKGUPURP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |