C19H23N3O4S — CID 122042099
2-[ethyl-[3-[[5-(2-nitrophenyl)thiophen-2-yl]methylamino]cyclobutyl]amino]acetic acid (PubChem CID 122042099) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-[ethyl-[3-[[5-(2-nitrophenyl)thiophen-2-yl]methylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[[5-(2-nitrophenyl)thiophen-2-yl]methylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122042099 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-[ethyl-[3-[[5-(2-nitrophenyl)thiophen-2-yl]methylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NCc2ccc(-c3ccccc3[N+](=O)[O-])s2)C1 |
| InChI | InChI=1S/C19H23N3O4S/c1-2-21(12-19(23)24)14-9-13(10-14)20-11-15-7-8-18(27-15)16-5-3-4-6-17(16)22(25)26/h3-8,13-14,20H,2,9-12H2,1H3,(H,23,24) |
| InChIKey | VTFWUPUOCJPHKE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|