C18H27BrN2O3 — CID 122042577
2-[[3-[(5-bromo-2-propoxyphenyl)methylamino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122042577) has the molecular formula C18H27BrN2O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is 2-[[3-[(5-bromo-2-propoxyphenyl)methylamino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[(5-bromo-2-propoxyphenyl)methylamino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122042577 |
| Molecular Formula | C18H27BrN2O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[[3-[(5-bromo-2-propoxyphenyl)methylamino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCCOc1ccc(Br)cc1CNC1CC(N(CC)CC(=O)O)C1 |
| InChI | InChI=1S/C18H27BrN2O3/c1-3-7-24-17-6-5-14(19)8-13(17)11-20-15-9-16(10-15)21(4-2)12-18(22)23/h5-6,8,15-16,20H,3-4,7,9-12H2,1-2H3,(H,22,23) |
| InChIKey | OLRBLAFHVAKMHP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |