C19H32N4O2 — CID 122042608
2-[[3-[(3-cyclohexyl-1-methylpyrazol-4-yl)methylamino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122042608) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[[3-[(3-cyclohexyl-1-methylpyrazol-4-yl)methylamino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[(3-cyclohexyl-1-methylpyrazol-4-yl)methylamino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122042608 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 2-[[3-[(3-cyclohexyl-1-methylpyrazol-4-yl)methylamino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NCc2cn(C)nc2C2CCCCC2)C1 |
| InChI | InChI=1S/C19H32N4O2/c1-3-23(13-18(24)25)17-9-16(10-17)20-11-15-12-22(2)21-19(15)14-7-5-4-6-8-14/h12,14,16-17,20H,3-11,13H2,1-2H3,(H,24,25) |
| InChIKey | HVCGVMAZLWNQAM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |