C21H33N3O3 — CID 122042725
2-[ethyl-[3-[[4-oxo-4-(2-propan-2-ylanilino)butan-2-yl]amino]cyclobutyl]amino]acetic acid (PubChem CID 122042725) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-[ethyl-[3-[[4-oxo-4-(2-propan-2-ylanilino)butan-2-yl]amino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[[4-oxo-4-(2-propan-2-ylanilino)butan-2-yl]amino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122042725 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 2-[ethyl-[3-[[4-oxo-4-(2-propan-2-ylanilino)butan-2-yl]amino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(C)CC(=O)Nc2ccccc2C(C)C)C1 |
| InChI | InChI=1S/C21H33N3O3/c1-5-24(13-21(26)27)17-11-16(12-17)22-15(4)10-20(25)23-19-9-7-6-8-18(19)14(2)3/h6-9,14-17,22H,5,10-13H2,1-4H3,(H,23,25)(H,26,27) |
| InChIKey | PNGRFLOTJNTRJW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |