C21H32N2O2 — CID 122042745
2-[ethyl-[3-[(4-methyl-4-phenylcyclohexyl)amino]cyclobutyl]amino]acetic acid (PubChem CID 122042745) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-[ethyl-[3-[(4-methyl-4-phenylcyclohexyl)amino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[(4-methyl-4-phenylcyclohexyl)amino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122042745 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 2-[ethyl-[3-[(4-methyl-4-phenylcyclohexyl)amino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC2CCC(C)(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H32N2O2/c1-3-23(15-20(24)25)19-13-18(14-19)22-17-9-11-21(2,12-10-17)16-7-5-4-6-8-16/h4-8,17-19,22H,3,9-15H2,1-2H3,(H,24,25) |
| InChIKey | QLPBJTDGIFANGM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |