C20H32N2O3 — CID 122043070
2-[ethyl-[1-[[4-(2-methylpropoxy)phenyl]methyl]piperidin-4-yl]amino]acetic acid (PubChem CID 122043070) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[ethyl-[1-[[4-(2-methylpropoxy)phenyl]methyl]piperidin-4-yl]amino]acetic acid.
| Compound Name | 2-[ethyl-[1-[[4-(2-methylpropoxy)phenyl]methyl]piperidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122043070 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 2-[ethyl-[1-[[4-(2-methylpropoxy)phenyl]methyl]piperidin-4-yl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CCN(Cc2ccc(OCC(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H32N2O3/c1-4-22(14-20(23)24)18-9-11-21(12-10-18)13-17-5-7-19(8-6-17)25-15-16(2)3/h5-8,16,18H,4,9-15H2,1-3H3,(H,23,24) |
| InChIKey | OIQTZHAXSVFIER-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |