C20H27NO2 — CID 122045055
(3aS,6aR)-2-(3-methyl-3-phenylcyclopentyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122045055) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (3aS,6aR)-2-(3-methyl-3-phenylcyclopentyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(3-methyl-3-phenylcyclopentyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122045055 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (3aS,6aR)-2-(3-methyl-3-phenylcyclopentyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | CC1(c2ccccc2)CCC(N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)C1 |
| InChI | InChI=1S/C20H27NO2/c1-19(15-6-3-2-4-7-15)11-9-17(12-19)21-13-16-8-5-10-20(16,14-21)18(22)23/h2-4,6-7,16-17H,5,8-14H2,1H3,(H,22,23)/t16-,17?,19?,20+/m0/s1 |
| InChIKey | UCQYQABZRORNBF-CLPROHDKSA-N |
| XLogP | 3.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |