C22H25NO3 — CID 122046172
3-methyl-1-[(E)-3-(4-phenylmethoxyphenyl)prop-2-enyl]pyrrolidine-3-carboxylic acid (PubChem CID 122046172) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-methyl-1-[(E)-3-(4-phenylmethoxyphenyl)prop-2-enyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[(E)-3-(4-phenylmethoxyphenyl)prop-2-enyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122046172 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 3-methyl-1-[(E)-3-(4-phenylmethoxyphenyl)prop-2-enyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C/C=C/c2ccc(OCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H25NO3/c1-22(21(24)25)13-15-23(17-22)14-5-8-18-9-11-20(12-10-18)26-16-19-6-3-2-4-7-19/h2-12H,13-17H2,1H3,(H,24,25)/b8-5+ |
| InChIKey | ZLMKZVANPVCTHO-VMPITWQZSA-N |
| XLogP | 4.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |