C15H20FNO2S — CID 122046198
1-[1-(3-fluoro-4-methylsulfanylphenyl)ethyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122046198) has the molecular formula C15H20FNO2S and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methylsulfanylphenyl)ethyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-(3-fluoro-4-methylsulfanylphenyl)ethyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122046198 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-[1-(3-fluoro-4-methylsulfanylphenyl)ethyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CSc1ccc(C(C)N2CCC(C)(C(=O)O)C2)cc1F |
| InChI | InChI=1S/C15H20FNO2S/c1-10(11-4-5-13(20-3)12(16)8-11)17-7-6-15(2,9-17)14(18)19/h4-5,8,10H,6-7,9H2,1-3H3,(H,18,19) |
| InChIKey | IFRDNSSQKPETGH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |