C11H11Br2NO2 — CID 122046748
1-[(3,5-dibromophenyl)methyl]azetidine-3-carboxylic acid (PubChem CID 122046748) has the molecular formula C11H11Br2NO2 and a molecular weight of 349.02 g/mol. Its IUPAC name is 1-[(3,5-dibromophenyl)methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(3,5-dibromophenyl)methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122046748 |
| Molecular Formula | C11H11Br2NO2 |
| Molecular Weight | 349.02 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | 1-[(3,5-dibromophenyl)methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2cc(Br)cc(Br)c2)C1 |
| InChI | InChI=1S/C11H11Br2NO2/c12-9-1-7(2-10(13)3-9)4-14-5-8(6-14)11(15)16/h1-3,8H,4-6H2,(H,15,16) |
| InChIKey | LTVAKKCIISFBFR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.02 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |