C16H16FN3O4S — CID 122047573
6-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]pyridine-2-carboxylic acid (PubChem CID 122047573) has the molecular formula C16H16FN3O4S and a molecular weight of 365.39 g/mol. Its IUPAC name is 6-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122047573 |
| Molecular Formula | C16H16FN3O4S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 6-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C16H16FN3O4S/c17-12-4-6-13(7-5-12)25(23,24)20-10-8-19(9-11-20)15-3-1-2-14(18-15)16(21)22/h1-7H,8-11H2,(H,21,22) |
| InChIKey | ZLZSONDZPBFPBT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |