C18H19N3O4 — CID 122047903
6-[[3-(oxolane-2-carbonylamino)phenyl]methylamino]pyridine-2-carboxylic acid (PubChem CID 122047903) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 6-[[3-(oxolane-2-carbonylamino)phenyl]methylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-[[3-(oxolane-2-carbonylamino)phenyl]methylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122047903 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-[[3-(oxolane-2-carbonylamino)phenyl]methylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(NCc2cccc(NC(=O)C3CCCO3)c2)n1 |
| InChI | InChI=1S/C18H19N3O4/c22-17(15-7-3-9-25-15)20-13-5-1-4-12(10-13)11-19-16-8-2-6-14(21-16)18(23)24/h1-2,4-6,8,10,15H,3,7,9,11H2,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | XKMBEAAZPKPPPQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |