C13H16N4O2 — CID 122047981
6-[3-(1-methylpyrazol-4-yl)propylamino]pyridine-2-carboxylic acid (PubChem CID 122047981) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-[3-(1-methylpyrazol-4-yl)propylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-[3-(1-methylpyrazol-4-yl)propylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122047981 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 6-[3-(1-methylpyrazol-4-yl)propylamino]pyridine-2-carboxylic acid |
| SMILES | Cn1cc(CCCNc2cccc(C(=O)O)n2)cn1 |
| InChI | InChI=1S/C13H16N4O2/c1-17-9-10(8-15-17)4-3-7-14-12-6-2-5-11(16-12)13(18)19/h2,5-6,8-9H,3-4,7H2,1H3,(H,14,16)(H,18,19) |
| InChIKey | USIFBYPNRPBUKG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|